C31H33Cl2N3O3S — CID 44536652
(E)-N-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylprop-2-enamide (PubChem CID 44536652) has the molecular formula C31H33Cl2N3O3S and a molecular weight of 598.60 g/mol. Its IUPAC name is (E)-N-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44536652 |
| Molecular Formula | C31H33Cl2N3O3S |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | (E)-N-[1-(3,4-dichlorophenyl)-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)propyl]-3-phenylprop-2-enamide |
| SMILES | CS(=O)(=O)N1CC2(CCN(CCC(NC(=O)/C=C/c3ccccc3)c3ccc(Cl)c(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C31H33Cl2N3O3S/c1-40(38,39)36-22-31(25-9-5-6-10-29(25)36)16-19-35(20-17-31)18-15-28(24-12-13-26(32)27(33)21-24)34-30(37)14-11-23-7-3-2-4-8-23/h2-14,21,28H,15-20,22H2,1H3,(H,34,37)/b14-11+ |
| InChIKey | CZLTVXNYOSUZAA-SDNWHVSQSA-N |
| XLogP | 6.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|