C18H14F2N2O2 — CID 44537803
(2-benzyl-5-methylpyrazol-3-yl) 2,6-difluorobenzoate (PubChem CID 44537803) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is (2-benzyl-5-methylpyrazol-3-yl) 2,6-difluorobenzoate.
| Compound Name | (2-benzyl-5-methylpyrazol-3-yl) 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 44537803 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2-benzyl-5-methylpyrazol-3-yl) 2,6-difluorobenzoate |
| SMILES | Cc1cc(OC(=O)c2c(F)cccc2F)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-12-10-16(22(21-12)11-13-6-3-2-4-7-13)24-18(23)17-14(19)8-5-9-15(17)20/h2-10H,11H2,1H3 |
| InChIKey | BIXANJDUWZVRNF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |