C19H20F3N3O2 — CID 44538172
N-[3-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 44538172) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-[3-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 44538172 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CCc2ccc(CC(=O)NN)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O2/c1-12(26)24-16-4-2-3-15(18(16)19(20,21)22)10-9-13-5-7-14(8-6-13)11-17(27)25-23/h2-8H,9-11,23H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | YMYDVZMMZAXWFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|