About [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride
[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride (PubChem CID 67030002) has the molecular formula C20H24ClN3O4
and a molecular weight of 405.88 g/mol. Its IUPAC name is [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride.
Molecular Properties
| Compound Name | [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride |
| PubChem CID | 67030002 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride |
| SMILES | CC(=O)NCC(=O)Oc1ccc(CCc2ccc(CC(=O)NN)cc2)cc1.Cl |
| InChI | InChI=1S/C20H23N3O4.ClH/c1-14(24)22-13-20(26)27-18-10-8-16(9-11-18)3-2-15-4-6-17(7-5-15)12-19(25)23-21;/h4-11H,2-3,12-13,21H2,1H3,(H,22,24)(H,23,25);1H |
| InChIKey | BGCZETHWSWUBDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride?
The IUPAC name of [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride (CID 67030002) is [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride.
What is the SMILES notation for [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride?
The canonical SMILES for [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride is CC(=O)NCC(=O)Oc1ccc(CCc2ccc(CC(=O)NN)cc2)cc1.Cl.
What is the InChIKey of [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride?
The InChIKey is BGCZETHWSWUBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4.ClH/c1-14(24)22-13-20(26)27-18-10-8-16(9-11-18)3-2-15-4-6-17(7-5-15)12-19(25)23-21;/h4-11H,2-3,12-13,21H2,1H3,(H,22,24)(H,23,25);1H.
What are the key properties of [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride?
[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride has a molecular weight of 405.88 g/mol, XLogP of 1.47, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride is sourced from PubChem (CID 67030002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).