C20H24ClN3O4 — CID 67030002
[4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride (PubChem CID 67030002) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride.
| Compound Name | [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride |
|---|---|
| PubChem CID | 67030002 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [4-[2-[4-(2-hydrazinyl-2-oxoethyl)phenyl]ethyl]phenyl] 2-acetamidoacetate;hydrochloride |
| SMILES | CC(=O)NCC(=O)Oc1ccc(CCc2ccc(CC(=O)NN)cc2)cc1.Cl |
| InChI | InChI=1S/C20H23N3O4.ClH/c1-14(24)22-13-20(26)27-18-10-8-16(9-11-18)3-2-15-4-6-17(7-5-15)12-19(25)23-21;/h4-11H,2-3,12-13,21H2,1H3,(H,22,24)(H,23,25);1H |
| InChIKey | BGCZETHWSWUBDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|