C25H27FN2O3 — CID 44538522
(3Z)-5-fluoro-3-[5-[2-(4-hydroxypiperidin-1-yl)ethyl]-3,3-dimethyl-2-benzofuran-1-ylidene]-1H-indol-2-one (PubChem CID 44538522) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is (3Z)-5-fluoro-3-[5-[2-(4-hydroxypiperidin-1-yl)ethyl]-3,3-dimethyl-2-benzofuran-1-ylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-fluoro-3-[5-[2-(4-hydroxypiperidin-1-yl)ethyl]-3,3-dimethyl-2-benzofuran-1-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 44538522 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (3Z)-5-fluoro-3-[5-[2-(4-hydroxypiperidin-1-yl)ethyl]-3,3-dimethyl-2-benzofuran-1-ylidene]-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2\C(=O)Nc3ccc(F)cc32)c2ccc(CCN3CCC(O)CC3)cc21 |
| InChI | InChI=1S/C25H27FN2O3/c1-25(2)20-13-15(7-10-28-11-8-17(29)9-12-28)3-5-18(20)23(31-25)22-19-14-16(26)4-6-21(19)27-24(22)30/h3-6,13-14,17,29H,7-12H2,1-2H3,(H,27,30)/b23-22- |
| InChIKey | MYRQUQXQGLKOKP-FCQUAONHSA-N |
| XLogP | 3.91 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|