C27H26N2O4 — CID 44539086
1-[4-[(4-methoxybenzoyl)amino]butyl]-3-phenylindole-6-carboxylic acid (PubChem CID 44539086) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[4-[(4-methoxybenzoyl)amino]butyl]-3-phenylindole-6-carboxylic acid.
| Compound Name | 1-[4-[(4-methoxybenzoyl)amino]butyl]-3-phenylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 44539086 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-[4-[(4-methoxybenzoyl)amino]butyl]-3-phenylindole-6-carboxylic acid |
| SMILES | COc1ccc(C(=O)NCCCCn2cc(-c3ccccc3)c3ccc(C(=O)O)cc32)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-33-22-12-9-20(10-13-22)26(30)28-15-5-6-16-29-18-24(19-7-3-2-4-8-19)23-14-11-21(27(31)32)17-25(23)29/h2-4,7-14,17-18H,5-6,15-16H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | HJNIOBUHHILCRH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|