C22H28O3 — CID 44540368
(2S)-2-[(3S,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]propanoic acid (PubChem CID 44540368) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2S)-2-[(3S,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]propanoic acid.
| Compound Name | (2S)-2-[(3S,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]propanoic acid |
|---|---|
| PubChem CID | 44540368 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2S)-2-[(3S,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]propanoic acid |
| SMILES | Cc1c([C@H](C)C(=O)O)ccc2c1CC1C2CC=C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C22H28O3/c1-12-16(13(2)21(24)25)6-7-17-18-5-4-14-10-15(23)8-9-22(14,3)20(18)11-19(12)17/h4,6-7,13,15,18,20,23H,5,8-11H2,1-3H3,(H,24,25)/t13-,15-,18?,20?,22-/m0/s1 |
| InChIKey | SFYLMUYJQHACOT-LRDSDGENSA-N |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|