C29H41NO5Si — CID 44542247
[(E,2S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 44542247) has the molecular formula C29H41NO5Si and a molecular weight of 511.74 g/mol. Its IUPAC name is [(E,2S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E,2S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 44542247 |
| Molecular Formula | C29H41NO5Si |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [(E,2S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C/C=C(\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO5Si/c1-9-23(22(2)34-26(31)20-30-27(32)35-28(3,4)5)21-33-36(29(6,7)8,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h9-19,22H,20-21H2,1-8H3,(H,30,32)/b23-9+/t22-/m0/s1 |
| InChIKey | QACJSMAPGWEREX-XVWINKBRSA-N |
| XLogP | 4.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|