C14H12Cl2N4 — CID 44542320
2-[(E)-[(3,4-dichlorophenyl)-phenylmethylidene]amino]guanidine (PubChem CID 44542320) has the molecular formula C14H12Cl2N4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-[(E)-[(3,4-dichlorophenyl)-phenylmethylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(3,4-dichlorophenyl)-phenylmethylidene]amino]guanidine |
|---|---|
| PubChem CID | 44542320 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-[(E)-[(3,4-dichlorophenyl)-phenylmethylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N4/c15-11-7-6-10(8-12(11)16)13(19-20-14(17)18)9-4-2-1-3-5-9/h1-8H,(H4,17,18,20)/b19-13+ |
| InChIKey | VFGBIVIJQQKAFH-CPNJWEJPSA-N |
| XLogP | 3.02 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|