C14H7F3N2OS — CID 44543405
2,2,2-trifluoro-1-(5-quinoxalin-6-ylthiophen-2-yl)ethanone (PubChem CID 44543405) has the molecular formula C14H7F3N2OS and a molecular weight of 308.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(5-quinoxalin-6-ylthiophen-2-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(5-quinoxalin-6-ylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 44543405 |
| Molecular Formula | C14H7F3N2OS |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2,2,2-trifluoro-1-(5-quinoxalin-6-ylthiophen-2-yl)ethanone |
| SMILES | O=C(c1ccc(-c2ccc3nccnc3c2)s1)C(F)(F)F |
| InChI | InChI=1S/C14H7F3N2OS/c15-14(16,17)13(20)12-4-3-11(21-12)8-1-2-9-10(7-8)19-6-5-18-9/h1-7H |
| InChIKey | PHBGFWHJUVWHAA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |