C19H12ClF3N2O4 — CID 44543792
4-(3-chlorophenyl)-2-methyl-5-nitro-6-(2,4,6-trifluorophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 44543792) has the molecular formula C19H12ClF3N2O4 and a molecular weight of 424.76 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2-methyl-5-nitro-6-(2,4,6-trifluorophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(3-chlorophenyl)-2-methyl-5-nitro-6-(2,4,6-trifluorophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 44543792 |
| Molecular Formula | C19H12ClF3N2O4 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 4-(3-chlorophenyl)-2-methyl-5-nitro-6-(2,4,6-trifluorophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(Cl)c2)C([N+](=O)[O-])=C(c2c(F)cc(F)cc2F)N1 |
| InChI | InChI=1S/C19H12ClF3N2O4/c1-8-14(19(26)27)15(9-3-2-4-10(20)5-9)18(25(28)29)17(24-8)16-12(22)6-11(21)7-13(16)23/h2-7,15,24H,1H3,(H,26,27) |
| InChIKey | LIMFPGCLPKTAAN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|