C25H29ClN4O6S2 — CID 44544070
(1R,10R,16E,21R)-21-[(3-chlorophenyl)methyl]spiro[2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-7,1'-cyclopropane]-3,6,9,19,22-pentone (PubChem CID 44544070) has the molecular formula C25H29ClN4O6S2 and a molecular weight of 581.12 g/mol. Its IUPAC name is (1R,10R,16E,21R)-21-[(3-chlorophenyl)methyl]spiro[2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-7,1'-cyclopropane]-3,6,9,19,22-pentone.
| Compound Name | (1R,10R,16E,21R)-21-[(3-chlorophenyl)methyl]spiro[2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-7,1'-cyclopropane]-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 44544070 |
| Molecular Formula | C25H29ClN4O6S2 |
| Molecular Weight | 581.12 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | (1R,10R,16E,21R)-21-[(3-chlorophenyl)methyl]spiro[2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-7,1'-cyclopropane]-3,6,9,19,22-pentone |
| SMILES | O=C1C[C@@H]2/C=C\CCSSC[C@H](NC(=O)[C@@H](Cc3cccc(Cl)c3)N1)C(=O)NC1(CC1)C(=O)NCC(=O)O2 |
| InChI | InChI=1S/C25H29ClN4O6S2/c26-16-5-3-4-15(10-16)11-18-22(33)29-19-14-38-37-9-2-1-6-17(12-20(31)28-18)36-21(32)13-27-24(35)25(7-8-25)30-23(19)34/h1,3-6,10,17-19H,2,7-9,11-14H2,(H,27,35)(H,28,31)(H,29,33)(H,30,34)/b6-1-/t17-,18+,19-/m0/s1 |
| InChIKey | IDZYQCGEBIAIAP-OIYVBDDPSA-N |
| XLogP | 1.27 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.12 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|