C23H36N4O6 — CID 44544422
(2S)-6-amino-2-[[(9S,12R)-9-methyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid (PubChem CID 44544422) has the molecular formula C23H36N4O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(9S,12R)-9-methyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(9S,12R)-9-methyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 44544422 |
| Molecular Formula | C23H36N4O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (2S)-6-amino-2-[[(9S,12R)-9-methyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid |
| SMILES | C[C@H]1COCCCCOc2ccc(cc2)C[C@@H](NC(=O)N[C@@H](CCCCN)C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C23H36N4O6/c1-16-15-32-12-4-5-13-33-18-9-7-17(8-10-18)14-20(21(28)25-16)27-23(31)26-19(22(29)30)6-2-3-11-24/h7-10,16,19-20H,2-6,11-15,24H2,1H3,(H,25,28)(H,29,30)(H2,26,27,31)/t16-,19-,20+/m0/s1 |
| InChIKey | YWCJFURUASFZHP-FFZOFVMBSA-N |
| XLogP | 1.17 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|