C28H44N4O6 — CID 44544420
(2S)-6-amino-2-[[(9S,12R)-9-cyclohexyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid (PubChem CID 44544420) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(9S,12R)-9-cyclohexyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(9S,12R)-9-cyclohexyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 44544420 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (2S)-6-amino-2-[[(9S,12R)-9-cyclohexyl-11-oxo-2,7-dioxa-10-azabicyclo[12.2.2]octadeca-1(16),14,17-trien-12-yl]carbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)N[C@@H]1Cc2ccc(cc2)OCCCCOC[C@H](C2CCCCC2)NC1=O)C(=O)O |
| InChI | InChI=1S/C28H44N4O6/c29-15-5-4-10-23(27(34)35)31-28(36)32-24-18-20-11-13-22(14-12-20)38-17-7-6-16-37-19-25(30-26(24)33)21-8-2-1-3-9-21/h11-14,21,23-25H,1-10,15-19,29H2,(H,30,33)(H,34,35)(H2,31,32,36)/t23-,24+,25+/m0/s1 |
| InChIKey | GGWRPAFPNBTEKN-ISJGIBHGSA-N |
| XLogP | 2.73 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|