C26H46N4O4 — CID 68553298
(2S)-2-[[1-[[(2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-6-aminohexanoic acid (PubChem CID 68553298) has the molecular formula C26H46N4O4 and a molecular weight of 478.68 g/mol. Its IUPAC name is (2S)-2-[[1-[[(2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-6-aminohexanoic acid.
| Compound Name | (2S)-2-[[1-[[(2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-6-aminohexanoic acid |
|---|---|
| PubChem CID | 68553298 |
| Molecular Formula | C26H46N4O4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (2S)-2-[[1-[[(2R)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-6-aminohexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)NC(CC1CCCCC1)C(=O)N[C@@H]1CCC2CCCCC2C1)C(=O)O |
| InChI | InChI=1S/C26H46N4O4/c27-15-7-6-12-22(25(32)33)29-26(34)30-23(16-18-8-2-1-3-9-18)24(31)28-21-14-13-19-10-4-5-11-20(19)17-21/h18-23H,1-17,27H2,(H,28,31)(H,32,33)(H2,29,30,34)/t19?,20?,21-,22+,23?/m1/s1 |
| InChIKey | UCEGGLPSQBLVBB-XGRXMRGWSA-N |
| XLogP | 3.68 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|