C25H44N4O4 — CID 25159804
(2S)-2-[[(2R)-1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-5-aminopentanoic acid (PubChem CID 25159804) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2S)-2-[[(2R)-1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-5-aminopentanoic acid.
| Compound Name | (2S)-2-[[(2R)-1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-5-aminopentanoic acid |
|---|---|
| PubChem CID | 25159804 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | (2S)-2-[[(2R)-1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]-5-aminopentanoic acid |
| SMILES | NCCC[C@H](NC(=O)N[C@H](CC1CCCCC1)C(=O)NC1CCC2CCCCC2C1)C(=O)O |
| InChI | InChI=1S/C25H44N4O4/c26-14-6-11-21(24(31)32)28-25(33)29-22(15-17-7-2-1-3-8-17)23(30)27-20-13-12-18-9-4-5-10-19(18)16-20/h17-22H,1-16,26H2,(H,27,30)(H,31,32)(H2,28,29,33)/t18?,19?,20?,21-,22+/m0/s1 |
| InChIKey | VHZQBDGBWGCXJH-PFNOACBWSA-N |
| XLogP | 3.29 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |