C20H40ClN5O4 — CID 174579575
(2S)-5-amino-2-[[(2R)-3-cyclohexyl-1-[2-(3-methylbutyl)hydrazinyl]-1-oxopropan-2-yl]carbamoylamino]pentanoic acid;hydrochloride (PubChem CID 174579575) has the molecular formula C20H40ClN5O4 and a molecular weight of 450.02 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2R)-3-cyclohexyl-1-[2-(3-methylbutyl)hydrazinyl]-1-oxopropan-2-yl]carbamoylamino]pentanoic acid;hydrochloride.
| Compound Name | (2S)-5-amino-2-[[(2R)-3-cyclohexyl-1-[2-(3-methylbutyl)hydrazinyl]-1-oxopropan-2-yl]carbamoylamino]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174579575 |
| Molecular Formula | C20H40ClN5O4 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (2S)-5-amino-2-[[(2R)-3-cyclohexyl-1-[2-(3-methylbutyl)hydrazinyl]-1-oxopropan-2-yl]carbamoylamino]pentanoic acid;hydrochloride |
| SMILES | CC(C)CCNNC(=O)[C@@H](CC1CCCCC1)NC(=O)N[C@@H](CCCN)C(=O)O.Cl |
| InChI | InChI=1S/C20H39N5O4.ClH/c1-14(2)10-12-22-25-18(26)17(13-15-7-4-3-5-8-15)24-20(29)23-16(19(27)28)9-6-11-21;/h14-17,22H,3-13,21H2,1-2H3,(H,25,26)(H,27,28)(H2,23,24,29);1H/t16-,17+;/m0./s1 |
| InChIKey | QSIWWVFRIGAPOW-MCJVGQIASA-N |
| XLogP | 1.91 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|