C21H38N4O4 — CID 71277098
6-amino-2-[[(2R)-3-cyclohexyl-1-(2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 71277098) has the molecular formula C21H38N4O4 and a molecular weight of 410.56 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-3-cyclohexyl-1-(2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2R)-3-cyclohexyl-1-(2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 71277098 |
| Molecular Formula | C21H38N4O4 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 6-amino-2-[[(2R)-3-cyclohexyl-1-(2-methylpyrrolidin-1-yl)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CC1CCCN1C(=O)[C@@H](CC1CCCCC1)NC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H38N4O4/c1-15-8-7-13-25(15)19(26)18(14-16-9-3-2-4-10-16)24-21(29)23-17(20(27)28)11-5-6-12-22/h15-18H,2-14,22H2,1H3,(H,27,28)(H2,23,24,29)/t15?,17?,18-/m1/s1 |
| InChIKey | ISGJHRGZGUNOGI-VMWRSERWSA-N |
| XLogP | 2.22 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|