C23H35ClN4O4 — CID 68548161
6-amino-2-[[(2R)-1-[(4-chlorophenyl)methylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 68548161) has the molecular formula C23H35ClN4O4 and a molecular weight of 467.01 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-1-[(4-chlorophenyl)methylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2R)-1-[(4-chlorophenyl)methylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 68548161 |
| Molecular Formula | C23H35ClN4O4 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 6-amino-2-[[(2R)-1-[(4-chlorophenyl)methylamino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)N[C@H](CC1CCCCC1)C(=O)NCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C23H35ClN4O4/c24-18-11-9-17(10-12-18)15-26-21(29)20(14-16-6-2-1-3-7-16)28-23(32)27-19(22(30)31)8-4-5-13-25/h9-12,16,19-20H,1-8,13-15,25H2,(H,26,29)(H,30,31)(H2,27,28,32)/t19?,20-/m1/s1 |
| InChIKey | VBPKSMGVSGMMAR-GFOWMXPYSA-N |
| XLogP | 3.18 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|