C22H40N4O4 — CID 68572008
6-amino-2-[[(2R)-3-cyclohexyl-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 68572008) has the molecular formula C22H40N4O4 and a molecular weight of 424.59 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-3-cyclohexyl-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2R)-3-cyclohexyl-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 68572008 |
| Molecular Formula | C22H40N4O4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 6-amino-2-[[(2R)-3-cyclohexyl-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)N[C@H](CC1CCCCC1)C(=O)NC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C22H40N4O4/c23-14-8-7-13-18(21(28)29)25-22(30)26-19(15-16-9-3-1-4-10-16)20(27)24-17-11-5-2-6-12-17/h16-19H,1-15,23H2,(H,24,27)(H,28,29)(H2,25,26,30)/t18?,19-/m1/s1 |
| InChIKey | CMEXWCUZEGJTGX-MUMRKEEXSA-N |
| XLogP | 2.66 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|