C21H34N4O4S — CID 25161238
(2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-(thiophen-3-ylmethylamino)propan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 25161238) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-(thiophen-3-ylmethylamino)propan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-(thiophen-3-ylmethylamino)propan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 25161238 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-(thiophen-3-ylmethylamino)propan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)N[C@H](CC1CCCCC1)C(=O)NCc1ccsc1)C(=O)O |
| InChI | InChI=1S/C21H34N4O4S/c22-10-5-4-8-17(20(27)28)24-21(29)25-18(12-15-6-2-1-3-7-15)19(26)23-13-16-9-11-30-14-16/h9,11,14-15,17-18H,1-8,10,12-13,22H2,(H,23,26)(H,27,28)(H2,24,25,29)/t17-,18+/m0/s1 |
| InChIKey | FMZGIGXVQFRBQJ-ZWKOTPCHSA-N |
| XLogP | 2.58 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|