C25H46N4O4 — CID 68544009
6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[(3,3,5-trimethylcyclohexyl)amino]propan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 68544009) has the molecular formula C25H46N4O4 and a molecular weight of 466.67 g/mol. Its IUPAC name is 6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[(3,3,5-trimethylcyclohexyl)amino]propan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[(3,3,5-trimethylcyclohexyl)amino]propan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 68544009 |
| Molecular Formula | C25H46N4O4 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[(3,3,5-trimethylcyclohexyl)amino]propan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | CC1CC(NC(=O)[C@H](CC2CCCCC2)NC(=O)NC(CCCCN)C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C25H46N4O4/c1-17-13-19(16-25(2,3)15-17)27-22(30)21(14-18-9-5-4-6-10-18)29-24(33)28-20(23(31)32)11-7-8-12-26/h17-21H,4-16,26H2,1-3H3,(H,27,30)(H,31,32)(H2,28,29,33)/t17?,19?,20?,21-/m0/s1 |
| InChIKey | KCWIRKPMQGKBAV-SLQSYFLNSA-N |
| XLogP | 3.54 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|