C18H16FNO — CID 44548163
4-[(E)-2-(5-fluoro-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 44548163) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[(E)-2-(5-fluoro-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(5-fluoro-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 44548163 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-[(E)-2-(5-fluoro-1-benzofuran-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc3cc(F)ccc3o2)cc1 |
| InChI | InChI=1S/C18H16FNO/c1-20(2)16-7-3-13(4-8-16)5-9-17-12-14-11-15(19)6-10-18(14)21-17/h3-12H,1-2H3/b9-5+ |
| InChIKey | VCLLMDCXDPWUSV-WEVVVXLNSA-N |
| XLogP | 4.81 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|