C14H10ClN3O2 — CID 44549275
1-(chloromethyl)-5-nitro-2,3-dihydro-1H-benzo[e]indole-6-carbonitrile (PubChem CID 44549275) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 1-(chloromethyl)-5-nitro-2,3-dihydro-1H-benzo[e]indole-6-carbonitrile.
| Compound Name | 1-(chloromethyl)-5-nitro-2,3-dihydro-1H-benzo[e]indole-6-carbonitrile |
|---|---|
| PubChem CID | 44549275 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-(chloromethyl)-5-nitro-2,3-dihydro-1H-benzo[e]indole-6-carbonitrile |
| SMILES | N#Cc1cccc2c3c(cc([N+](=O)[O-])c12)NCC3CCl |
| InChI | InChI=1S/C14H10ClN3O2/c15-5-9-7-17-11-4-12(18(19)20)14-8(6-16)2-1-3-10(14)13(9)11/h1-4,9,17H,5,7H2 |
| InChIKey | FNJGZIXPCOAKBH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|