C33H44N2O9 — CID 44551314
[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 44551314) has the molecular formula C33H44N2O9 and a molecular weight of 612.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 44551314 |
| Molecular Formula | C33H44N2O9 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-3-yl] (2S)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](OC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)OCc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H44N2O9/c1-2-3-4-5-6-12-17-41-32-29(38)28(37)30(27(20-36)43-32)44-31(39)26(18-23-19-34-25-16-11-10-15-24(23)25)35-33(40)42-21-22-13-8-7-9-14-22/h7-11,13-16,19,26-30,32,34,36-38H,2-6,12,17-18,20-21H2,1H3,(H,35,40)/t26-,27+,28+,29+,30+,32+/m0/s1 |
| InChIKey | VJGLQOJQOFOOHP-HDJPIGHGSA-N |
| XLogP | 3.73 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|