C18H28O2Si — CID 44551606
trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane (PubChem CID 44551606) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane.
| Compound Name | trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 44551606 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](C)(C)C)/C(C)=C/O[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H28O2Si/c1-8-18(20-21(5,6)7)15(3)13-19-16(4)17-11-9-14(2)10-12-17/h8-13,16H,1-7H3/b15-13+,18-8-/t16-/m1/s1 |
| InChIKey | UXWJANMOJJRPEN-VNRFGGIDSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|