About trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane
trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane (PubChem CID 44551606) has the molecular formula C18H28O2Si
and a molecular weight of 304.51 g/mol. Its IUPAC name is trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane |
| PubChem CID | 44551606 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane |
| SMILES | C/C=C(O[Si](C)(C)C)/C(C)=C/O[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H28O2Si/c1-8-18(20-21(5,6)7)15(3)13-19-16(4)17-11-9-14(2)10-12-17/h8-13,16H,1-7H3/b15-13+,18-8-/t16-/m1/s1 |
| InChIKey | UXWJANMOJJRPEN-VNRFGGIDSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane?
The IUPAC name of trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane (CID 44551606) is trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane.
What is the SMILES notation for trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane?
The canonical SMILES for trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane is C/C=C(O[Si](C)(C)C)/C(C)=C/O[C@H](C)c1ccc(C)cc1.
What is the InChIKey of trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane?
The InChIKey is UXWJANMOJJRPEN-VNRFGGIDSA-N. The full InChI is InChI=1S/C18H28O2Si/c1-8-18(20-21(5,6)7)15(3)13-19-16(4)17-11-9-14(2)10-12-17/h8-13,16H,1-7H3/b15-13+,18-8-/t16-/m1/s1.
What are the key properties of trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane?
trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane has a molecular weight of 304.51 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1E,3Z)-2-methyl-1-[(1R)-1-(4-methylphenyl)ethoxy]penta-1,3-dien-3-yl]oxysilane is sourced from PubChem (CID 44551606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).