C15H10FN3O — CID 44554966
5-fluoro-2-(1-methylindol-5-yl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 44554966) has the molecular formula C15H10FN3O and a molecular weight of 267.26 g/mol. Its IUPAC name is 5-fluoro-2-(1-methylindol-5-yl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-fluoro-2-(1-methylindol-5-yl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 44554966 |
| Molecular Formula | C15H10FN3O |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-fluoro-2-(1-methylindol-5-yl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cn1ccc2cc(-c3nc4ccc(F)nc4o3)ccc21 |
| InChI | InChI=1S/C15H10FN3O/c1-19-7-6-9-8-10(2-4-12(9)19)14-17-11-3-5-13(16)18-15(11)20-14/h2-8H,1H3 |
| InChIKey | OKVULDCXODWSFZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|