C14H15Cl2N3O — CID 44555588
4,6-dichloro-N-[(3R)-piperidin-3-yl]-1H-indole-2-carboxamide (PubChem CID 44555588) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 4,6-dichloro-N-[(3R)-piperidin-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[(3R)-piperidin-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 44555588 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4,6-dichloro-N-[(3R)-piperidin-3-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H15Cl2N3O/c15-8-4-11(16)10-6-13(19-12(10)5-8)14(20)18-9-2-1-3-17-7-9/h4-6,9,17,19H,1-3,7H2,(H,18,20)/t9-/m1/s1 |
| InChIKey | GHOALDKZWGGXCM-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |