C19H22Cl2N2O — CID 155545377
4,6-dichloro-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide (PubChem CID 155545377) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 4,6-dichloro-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155545377 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4,6-dichloro-N-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](NC(=O)c1cc3c(Cl)cc(Cl)cc3[nH]1)C2 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-18(2)10-4-5-19(18,3)16(6-10)23-17(24)15-9-12-13(21)7-11(20)8-14(12)22-15/h7-10,16,22H,4-6H2,1-3H3,(H,23,24)/t10-,16+,19-/m0/s1 |
| InChIKey | CGYLRHPALQBQAM-KEMVTONXSA-N |
| XLogP | 5.42 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |