C19H26F3N5O — CID 44556205
3-[[(2S)-azetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine (PubChem CID 44556205) has the molecular formula C19H26F3N5O and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[[(2S)-azetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine.
| Compound Name | 3-[[(2S)-azetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine |
|---|---|
| PubChem CID | 44556205 |
| Molecular Formula | C19H26F3N5O |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 3-[[(2S)-azetidin-2-yl]methoxy]-5-[4-(7,7,7-trifluoro-2-methylheptan-2-yl)triazol-1-yl]pyridine |
| SMILES | CC(C)(CCCCC(F)(F)F)c1cn(-c2cncc(OC[C@@H]3CCN3)c2)nn1 |
| InChI | InChI=1S/C19H26F3N5O/c1-18(2,6-3-4-7-19(20,21)22)17-12-27(26-25-17)15-9-16(11-23-10-15)28-13-14-5-8-24-14/h9-12,14,24H,3-8,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | WQDSXHXBHXULKV-AWEZNQCLSA-N |
| XLogP | 3.80 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|