C14H6Br2O3S2 — CID 44556553
2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarbaldehyde (PubChem CID 44556553) has the molecular formula C14H6Br2O3S2 and a molecular weight of 446.14 g/mol. Its IUPAC name is 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarbaldehyde.
| Compound Name | 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 44556553 |
| Molecular Formula | C14H6Br2O3S2 |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 443.81 |
| IUPAC Name | 2,5-bis(5-bromothiophen-2-yl)furan-3,4-dicarbaldehyde |
| SMILES | O=Cc1c(-c2ccc(Br)s2)oc(-c2ccc(Br)s2)c1C=O |
| InChI | InChI=1S/C14H6Br2O3S2/c15-11-3-1-9(20-11)13-7(5-17)8(6-18)14(19-13)10-2-4-12(16)21-10/h1-6H |
| InChIKey | GMUPBLSCANIUFD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|