C14H13ClN2OS — CID 44560122
O-(2-pyridin-2-ylethyl) N-(3-chlorophenyl)carbamothioate (PubChem CID 44560122) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is O-(2-pyridin-2-ylethyl) N-(3-chlorophenyl)carbamothioate.
| Compound Name | O-(2-pyridin-2-ylethyl) N-(3-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 44560122 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | O-(2-pyridin-2-ylethyl) N-(3-chlorophenyl)carbamothioate |
| SMILES | S=C(Nc1cccc(Cl)c1)OCCc1ccccn1 |
| InChI | InChI=1S/C14H13ClN2OS/c15-11-4-3-6-13(10-11)17-14(19)18-9-7-12-5-1-2-8-16-12/h1-6,8,10H,7,9H2,(H,17,19) |
| InChIKey | SUMJVEMFABOPCC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|