About O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate
O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate (PubChem CID 44560127) has the molecular formula C15H13N3OS
and a molecular weight of 283.36 g/mol. Its IUPAC name is O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate |
| PubChem CID | 44560127 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate |
| SMILES | N#Cc1ccc(NC(=S)OCCc2ccccn2)cc1 |
| InChI | InChI=1S/C15H13N3OS/c16-11-12-4-6-14(7-5-12)18-15(20)19-10-8-13-3-1-2-9-17-13/h1-7,9H,8,10H2,(H,18,20) |
| InChIKey | ZLKMUJRRHISONJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate?
The IUPAC name of O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate (CID 44560127) is O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate.
What is the SMILES notation for O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate?
The canonical SMILES for O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate is N#Cc1ccc(NC(=S)OCCc2ccccn2)cc1.
What is the InChIKey of O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate?
The InChIKey is ZLKMUJRRHISONJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS/c16-11-12-4-6-14(7-5-12)18-15(20)19-10-8-13-3-1-2-9-17-13/h1-7,9H,8,10H2,(H,18,20).
What are the key properties of O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate?
O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate has a molecular weight of 283.36 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-pyridin-2-ylethyl) N-(4-cyanophenyl)carbamothioate is sourced from PubChem (CID 44560127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).