C25H32ClN3O — CID 44560242
4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 44560242) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 44560242 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1C(c1ccc(Cl)cc1)N1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H32ClN3O/c1-19-7-5-6-10-23(19)24(20-11-13-21(26)14-12-20)28-15-17-29(18-16-28)25(30)27-22-8-3-2-4-9-22/h5-7,10-14,22,24H,2-4,8-9,15-18H2,1H3,(H,27,30) |
| InChIKey | OLLPWANHULOQCI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |