C26H34ClN3O — CID 44560243
4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cycloheptylpiperazine-1-carboxamide (PubChem CID 44560243) has the molecular formula C26H34ClN3O and a molecular weight of 440.03 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cycloheptylpiperazine-1-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cycloheptylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 44560243 |
| Molecular Formula | C26H34ClN3O |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 4-[(4-chlorophenyl)-(2-methylphenyl)methyl]-N-cycloheptylpiperazine-1-carboxamide |
| SMILES | Cc1ccccc1C(c1ccc(Cl)cc1)N1CCN(C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C26H34ClN3O/c1-20-8-6-7-11-24(20)25(21-12-14-22(27)15-13-21)29-16-18-30(19-17-29)26(31)28-23-9-4-2-3-5-10-23/h6-8,11-15,23,25H,2-5,9-10,16-19H2,1H3,(H,28,31) |
| InChIKey | AMOQRGVXFGDBST-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |