C19H17ClF3N3O3S — CID 44561155
(2R,3R)-3-[3-(2-chloro-4-methylsulfonylphenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine (PubChem CID 44561155) has the molecular formula C19H17ClF3N3O3S and a molecular weight of 459.88 g/mol. Its IUPAC name is (2R,3R)-3-[3-(2-chloro-4-methylsulfonylphenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine.
| Compound Name | (2R,3R)-3-[3-(2-chloro-4-methylsulfonylphenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 44561155 |
| Molecular Formula | C19H17ClF3N3O3S |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (2R,3R)-3-[3-(2-chloro-4-methylsulfonylphenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
| SMILES | C[C@@H](c1nc(-c2ccc(S(C)(=O)=O)cc2Cl)no1)[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H17ClF3N3O3S/c1-9(17(24)6-10-5-15(22)16(23)8-14(10)21)19-25-18(26-29-19)12-4-3-11(7-13(12)20)30(2,27)28/h3-5,7-9,17H,6,24H2,1-2H3/t9-,17-/m1/s1 |
| InChIKey | OTZXRISPQCJEIY-VVVCHXIZSA-N |
| XLogP | 3.88 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|