C23H26N6O2 — CID 44561428
4-(benzylamino)-2-[4-(4-hydroxypiperidin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 44561428) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-(benzylamino)-2-[4-(4-hydroxypiperidin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(benzylamino)-2-[4-(4-hydroxypiperidin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44561428 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-(benzylamino)-2-[4-(4-hydroxypiperidin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCC(O)CC3)cc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C23H26N6O2/c24-21(31)20-15-26-23(28-22(20)25-14-16-4-2-1-3-5-16)27-17-6-8-18(9-7-17)29-12-10-19(30)11-13-29/h1-9,15,19,30H,10-14H2,(H2,24,31)(H2,25,26,27,28) |
| InChIKey | ZNGBJFKIAYXGNA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|