C20H37NO — CID 44561506
(2E)-5,9-dimethyl-N-octyldeca-2,8-dienamide (PubChem CID 44561506) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is (2E)-5,9-dimethyl-N-octyldeca-2,8-dienamide.
| Compound Name | (2E)-5,9-dimethyl-N-octyldeca-2,8-dienamide |
|---|---|
| PubChem CID | 44561506 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (2E)-5,9-dimethyl-N-octyldeca-2,8-dienamide |
| SMILES | CCCCCCCCNC(=O)/C=C/CC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H37NO/c1-5-6-7-8-9-10-17-21-20(22)16-12-15-19(4)14-11-13-18(2)3/h12-13,16,19H,5-11,14-15,17H2,1-4H3,(H,21,22)/b16-12+ |
| InChIKey | HQRHYKPTSVGPJL-FOWTUZBSSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|