C29H25N6NaO8S — CID 44562094
sodium [(2R,3S,4R,5R)-5-[6-amino-2-(4-phenylphenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxysulfonyl-(2-hydroxybenzoyl)azanide (PubChem CID 44562094) has the molecular formula C29H25N6NaO8S and a molecular weight of 640.61 g/mol. Its IUPAC name is sodium [(2R,3S,4R,5R)-5-[6-amino-2-(4-phenylphenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxysulfonyl-(2-hydroxybenzoyl)azanide.
| Compound Name | sodium [(2R,3S,4R,5R)-5-[6-amino-2-(4-phenylphenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxysulfonyl-(2-hydroxybenzoyl)azanide |
|---|---|
| PubChem CID | 44562094 |
| Molecular Formula | C29H25N6NaO8S |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | sodium [(2R,3S,4R,5R)-5-[6-amino-2-(4-phenylphenyl)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxysulfonyl-(2-hydroxybenzoyl)azanide |
| SMILES | Nc1nc(-c2ccc(-c3ccccc3)cc2)nc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)[N-]C(=O)c2ccccc2O)[C@@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C29H26N6O8S.Na/c30-25-22-27(33-26(32-25)18-12-10-17(11-13-18)16-6-2-1-3-7-16)35(15-31-22)29-24(38)23(37)21(43-29)14-42-44(40,41)34-28(39)19-8-4-5-9-20(19)36;/h1-13,15,21,23-24,29,37-38H,14H2,(H4,30,32,33,34,36,39);/q;+1/p-1/t21-,23-,24-,29-;/m1./s1 |
| InChIKey | BAMRGJQPDOBSTO-HMPRVOSNSA-M |
| XLogP | -0.45 |
| TPSA | 214.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |