C22H24ClN3O2 — CID 44562416
2-(3-chlorophenoxy)-N-[1-(1H-indol-5-ylmethyl)piperidin-4-yl]acetamide (PubChem CID 44562416) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[1-(1H-indol-5-ylmethyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[1-(1H-indol-5-ylmethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 44562416 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[1-(1H-indol-5-ylmethyl)piperidin-4-yl]acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NC1CCN(Cc2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C22H24ClN3O2/c23-18-2-1-3-20(13-18)28-15-22(27)25-19-7-10-26(11-8-19)14-16-4-5-21-17(12-16)6-9-24-21/h1-6,9,12-13,19,24H,7-8,10-11,14-15H2,(H,25,27) |
| InChIKey | UWLYGOUWVQJEGP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |