C19H20N2 — CID 44563890
2,3-bis(4-methylphenyl)-6,7-dihydro-5H-1,4-diazepine (PubChem CID 44563890) has the molecular formula C19H20N2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 2,3-bis(4-methylphenyl)-6,7-dihydro-5H-1,4-diazepine.
| Compound Name | 2,3-bis(4-methylphenyl)-6,7-dihydro-5H-1,4-diazepine |
|---|---|
| PubChem CID | 44563890 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2,3-bis(4-methylphenyl)-6,7-dihydro-5H-1,4-diazepine |
| SMILES | CC1=CC=C(C=C1)C2=NCCCN=C2C3=CC=C(C=C3)C |
| InChI | InChI=1S/C19H20N2/c1-14-4-8-16(9-5-14)18-19(21-13-3-12-20-18)17-10-6-15(2)7-11-17/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | ZXLRGKSLGNJSIS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 356 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |