C17H22N2O3 — CID 44564105
[2-(1-adamantylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 44564105) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 44564105 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22N2O3/c20-15(10-22-16(21)14-2-1-3-18-14)19-17-7-11-4-12(8-17)6-13(5-11)9-17/h1-3,11-13,18H,4-10H2,(H,19,20) |
| InChIKey | CRULCOXCGZSQFG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |