C16H13F3N6O — CID 44564691
5-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 44564691) has the molecular formula C16H13F3N6O and a molecular weight of 362.32 g/mol. Its IUPAC name is 5-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 44564691 |
| Molecular Formula | C16H13F3N6O |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-(pyridin-4-ylmethylamino)-N-[3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1n[nH]nc1NCc1ccncc1 |
| InChI | InChI=1S/C16H13F3N6O/c17-16(18,19)11-2-1-3-12(8-11)22-15(26)13-14(24-25-23-13)21-9-10-4-6-20-7-5-10/h1-8H,9H2,(H,22,26)(H2,21,23,24,25) |
| InChIKey | NMPGUZLHFICNGL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |