C26H34N4O5 — CID 44565433
[8,11-dimethyl-3,5-dioxo-4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate (PubChem CID 44565433) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [8,11-dimethyl-3,5-dioxo-4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate.
| Compound Name | [8,11-dimethyl-3,5-dioxo-4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate |
|---|---|
| PubChem CID | 44565433 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [8,11-dimethyl-3,5-dioxo-4-[3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-4-azatricyclo[5.2.2.02,6]undec-8-en-1-yl] acetate |
| SMILES | CC(=O)OC12C=C(C)C(C(C)C1)C1C(=O)N(OCCCN3CCN(c4ccccn4)CC3)C(=O)C12 |
| InChI | InChI=1S/C26H34N4O5/c1-17-15-26(35-19(3)31)16-18(2)21(17)22-23(26)25(33)30(24(22)32)34-14-6-9-28-10-12-29(13-11-28)20-7-4-5-8-27-20/h4-5,7-8,15,18,21-23H,6,9-14,16H2,1-3H3 |
| InChIKey | UQSHHWKIQCOPBU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|