C30H46N4O4 — CID 3069581
[1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] decanoate (PubChem CID 3069581) has the molecular formula C30H46N4O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is [1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] decanoate.
| Compound Name | [1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] decanoate |
|---|---|
| PubChem CID | 3069581 |
| Molecular Formula | C30H46N4O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | [1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C30H46N4O4/c1-2-3-4-5-6-7-8-16-28(35)38-24(23-34-29(36)25-13-9-10-14-26(25)30(34)37)22-32-18-20-33(21-19-32)27-15-11-12-17-31-27/h11-12,15,17,24-26H,2-10,13-14,16,18-23H2,1H3 |
| InChIKey | LTCAJIRQSDBOTB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|