C23H21Cl2N5O3 — CID 44565601
N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-methoxybenzamide (PubChem CID 44565601) has the molecular formula C23H21Cl2N5O3 and a molecular weight of 486.36 g/mol. Its IUPAC name is N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-methoxybenzamide.
| Compound Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 44565601 |
| Molecular Formula | C23H21Cl2N5O3 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[4-chloro-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(OC)c1)N(C)C |
| InChI | InChI=1S/C23H21Cl2N5O3/c1-30(2)21(26)13-4-7-16(19(10-13)33-3)22(31)28-18-8-5-14(24)11-17(18)23(32)29-20-9-6-15(25)12-27-20/h4-12,26H,1-3H3,(H,28,31)(H,27,29,32)/b26-21- |
| InChIKey | LSMJZFDWGCGIDB-QLYXXIJNSA-N |
| XLogP | 4.79 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|