C22H34O6 — CID 44566458
[(2S,3R,4R,5R,8R,11S,15S)-15-hydroxy-5,8,11,15-tetramethyl-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate (PubChem CID 44566458) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is [(2S,3R,4R,5R,8R,11S,15S)-15-hydroxy-5,8,11,15-tetramethyl-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5R,8R,11S,15S)-15-hydroxy-5,8,11,15-tetramethyl-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
|---|---|
| PubChem CID | 44566458 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [(2S,3R,4R,5R,8R,11S,15S)-15-hydroxy-5,8,11,15-tetramethyl-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2C3C[C@](C)(O)C(=O)CC[C@]4(C)OC[C@H](C)C(C[C@H]1C)[C@@H]2C4O3 |
| InChI | InChI=1S/C22H34O6/c1-11-8-14-12(2)10-26-22(5)7-6-16(24)21(4,25)9-15-18(17(14)20(22)28-15)19(11)27-13(3)23/h11-12,14-15,17-20,25H,6-10H2,1-5H3/t11-,12+,14?,15?,17+,18+,19-,20?,21+,22+/m1/s1 |
| InChIKey | XZPFJFYBJFLLCW-UXWHGGPCSA-N |
| XLogP | 2.50 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |