C28H46O5 — CID 163040898
1-(4,5-dihydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl)octan-1-one (PubChem CID 163040898) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is 1-(4,5-dihydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl)octan-1-one.
| Compound Name | 1-(4,5-dihydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl)octan-1-one |
|---|---|
| PubChem CID | 163040898 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 1-(4,5-dihydroxy-4,8,11-trimethyl-15-methylidene-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-5-yl)octan-1-one |
| SMILES | C=C1CCCC2(C)OCC(C)C3CC(O)(C(=O)CCCCCCC)C(C)(O)C4C(C1)OC2C34 |
| InChI | InChI=1S/C28H46O5/c1-6-7-8-9-10-13-22(29)28(31)16-20-19(3)17-32-26(4)14-11-12-18(2)15-21-24(27(28,5)30)23(20)25(26)33-21/h19-21,23-25,30-31H,2,6-17H2,1,3-5H3 |
| InChIKey | OTRIFEDLHGALEL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|