C25H40O5 — CID 163067309
(3a,9b-dihydroxy-5,8-dimethyl-1-methylidene-4,5,5a,6,9,9a-hexahydrobenzo[e][1]benzofuran-9-yl) decanoate (PubChem CID 163067309) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (3a,9b-dihydroxy-5,8-dimethyl-1-methylidene-4,5,5a,6,9,9a-hexahydrobenzo[e][1]benzofuran-9-yl) decanoate.
| Compound Name | (3a,9b-dihydroxy-5,8-dimethyl-1-methylidene-4,5,5a,6,9,9a-hexahydrobenzo[e][1]benzofuran-9-yl) decanoate |
|---|---|
| PubChem CID | 163067309 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (3a,9b-dihydroxy-5,8-dimethyl-1-methylidene-4,5,5a,6,9,9a-hexahydrobenzo[e][1]benzofuran-9-yl) decanoate |
| SMILES | C=C1COC2(O)CC(C)C3CC=C(C)C(OC(=O)CCCCCCCCC)C3C12O |
| InChI | InChI=1S/C25H40O5/c1-5-6-7-8-9-10-11-12-21(26)30-23-17(2)13-14-20-18(3)15-24(27)25(28,22(20)23)19(4)16-29-24/h13,18,20,22-23,27-28H,4-12,14-16H2,1-3H3 |
| InChIKey | TZGWPDGXUWHIHH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|