C13H20O6 — CID 85158634
(3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl) hexanoate (PubChem CID 85158634) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl) hexanoate.
| Compound Name | (3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl) hexanoate |
|---|---|
| PubChem CID | 85158634 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl) hexanoate |
| SMILES | CCCCCC(=O)OC1C(O)COC12COC(=O)C2 |
| InChI | InChI=1S/C13H20O6/c1-2-3-4-5-10(15)19-12-9(14)7-18-13(12)6-11(16)17-8-13/h9,12,14H,2-8H2,1H3 |
| InChIKey | BSPDBROUVLBHSZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|